C16H31NO — CID 102848130
3-methyl-N-(1-oxaspiro[4.5]decan-2-ylmethyl)pentan-3-amine (PubChem CID 102848130) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 3-methyl-N-(1-oxaspiro[4.5]decan-2-ylmethyl)pentan-3-amine.
| Compound Name | 3-methyl-N-(1-oxaspiro[4.5]decan-2-ylmethyl)pentan-3-amine |
|---|---|
| PubChem CID | 102848130 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 3-methyl-N-(1-oxaspiro[4.5]decan-2-ylmethyl)pentan-3-amine |
| SMILES | CCC(C)(CC)NCC1CCC2(CCCCC2)O1 |
| InChI | InChI=1S/C16H31NO/c1-4-15(3,5-2)17-13-14-9-12-16(18-14)10-7-6-8-11-16/h14,17H,4-13H2,1-3H3 |
| InChIKey | QIOIXYXYLHMMBS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |