C14H24F3NO2 — CID 102897299
N-(1-oxaspiro[4.5]decan-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 102897299) has the molecular formula C14H24F3NO2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(1-oxaspiro[4.5]decan-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-(1-oxaspiro[4.5]decan-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 102897299 |
| Molecular Formula | C14H24F3NO2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-(1-oxaspiro[4.5]decan-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)(F)COCCNCC1CCC2(CCCCC2)O1 |
| InChI | InChI=1S/C14H24F3NO2/c15-14(16,17)11-19-9-8-18-10-12-4-7-13(20-12)5-2-1-3-6-13/h12,18H,1-11H2 |
| InChIKey | RPHSIWDQOHLCMT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|