C15H22ClNO3S — CID 102848383
3-[2-(4-chlorophenyl)sulfonylethyl-cyclobutylamino]propan-1-ol (PubChem CID 102848383) has the molecular formula C15H22ClNO3S and a molecular weight of 331.86 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)sulfonylethyl-cyclobutylamino]propan-1-ol.
| Compound Name | 3-[2-(4-chlorophenyl)sulfonylethyl-cyclobutylamino]propan-1-ol |
|---|---|
| PubChem CID | 102848383 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.86 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[2-(4-chlorophenyl)sulfonylethyl-cyclobutylamino]propan-1-ol |
| SMILES | O=S(=O)(CCN(CCCO)C1CCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClNO3S/c16-13-5-7-15(8-6-13)21(19,20)12-10-17(9-2-11-18)14-3-1-4-14/h5-8,14,18H,1-4,9-12H2 |
| InChIKey | FQEYFCIMHVWFEE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |