C14H26N2O — CID 102849336
2-(oxolan-3-ylmethyl)-2,8-diazaspiro[5.5]undecane (PubChem CID 102849336) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-(oxolan-3-ylmethyl)-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102849336 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)-2,8-diazaspiro[5.5]undecane |
| SMILES | C1CNCC2(C1)CCCN(CC1CCOC1)C2 |
| InChI | InChI=1S/C14H26N2O/c1-4-14(11-15-6-1)5-2-7-16(12-14)9-13-3-8-17-10-13/h13,15H,1-12H2 |
| InChIKey | QXSDPHJPHOUCQW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |