C13H26N2O — CID 115100731
6,6-dimethyl-1-(oxan-4-ylmethyl)-1,4-diazepane (PubChem CID 115100731) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 6,6-dimethyl-1-(oxan-4-ylmethyl)-1,4-diazepane.
| Compound Name | 6,6-dimethyl-1-(oxan-4-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 115100731 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 6,6-dimethyl-1-(oxan-4-ylmethyl)-1,4-diazepane |
| SMILES | CC1(C)CNCCN(CC2CCOCC2)C1 |
| InChI | InChI=1S/C13H26N2O/c1-13(2)10-14-5-6-15(11-13)9-12-3-7-16-8-4-12/h12,14H,3-11H2,1-2H3 |
| InChIKey | RFODABWBRKVKPE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |