C16H28N2O2 — CID 102849816
1-(2,8-diazaspiro[5.5]undecan-2-yl)-2-(oxan-2-yl)ethanone (PubChem CID 102849816) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(2,8-diazaspiro[5.5]undecan-2-yl)-2-(oxan-2-yl)ethanone.
| Compound Name | 1-(2,8-diazaspiro[5.5]undecan-2-yl)-2-(oxan-2-yl)ethanone |
|---|---|
| PubChem CID | 102849816 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-(2,8-diazaspiro[5.5]undecan-2-yl)-2-(oxan-2-yl)ethanone |
| SMILES | O=C(CC1CCCCO1)N1CCCC2(CCCNC2)C1 |
| InChI | InChI=1S/C16H28N2O2/c19-15(11-14-5-1-2-10-20-14)18-9-4-7-16(13-18)6-3-8-17-12-16/h14,17H,1-13H2 |
| InChIKey | DRZXHHYYFKMFJU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |