C17H30N2O — CID 102849929
2-cyclohexyl-1-(2,8-diazaspiro[5.5]undecan-2-yl)ethanone (PubChem CID 102849929) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-cyclohexyl-1-(2,8-diazaspiro[5.5]undecan-2-yl)ethanone.
| Compound Name | 2-cyclohexyl-1-(2,8-diazaspiro[5.5]undecan-2-yl)ethanone |
|---|---|
| PubChem CID | 102849929 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2-cyclohexyl-1-(2,8-diazaspiro[5.5]undecan-2-yl)ethanone |
| SMILES | O=C(CC1CCCCC1)N1CCCC2(CCCNC2)C1 |
| InChI | InChI=1S/C17H30N2O/c20-16(12-15-6-2-1-3-7-15)19-11-5-9-17(14-19)8-4-10-18-13-17/h15,18H,1-14H2 |
| InChIKey | YINADGYMZSPJPQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |