C15H28N2O2 — CID 102850302
ethyl 2-(2,8-diazaspiro[5.5]undecan-2-yl)butanoate (PubChem CID 102850302) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is ethyl 2-(2,8-diazaspiro[5.5]undecan-2-yl)butanoate.
| Compound Name | ethyl 2-(2,8-diazaspiro[5.5]undecan-2-yl)butanoate |
|---|---|
| PubChem CID | 102850302 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | ethyl 2-(2,8-diazaspiro[5.5]undecan-2-yl)butanoate |
| SMILES | CCOC(=O)C(CC)N1CCCC2(CCCNC2)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-3-13(14(18)19-4-2)17-10-6-8-15(12-17)7-5-9-16-11-15/h13,16H,3-12H2,1-2H3 |
| InChIKey | QTNRUUJLEYJNFS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |