About ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate
ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate (PubChem CID 102850177) has the molecular formula C14H25N3O3
and a molecular weight of 283.37 g/mol. Its IUPAC name is ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate |
| PubChem CID | 102850177 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN1CCCC2(CCCNC2)C1 |
| InChI | InChI=1S/C14H25N3O3/c1-2-20-13(19)16-12(18)9-17-8-4-6-14(11-17)5-3-7-15-10-14/h15H,2-11H2,1H3,(H,16,18,19) |
| InChIKey | LPKULXWERDZHBA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate?
The IUPAC name of ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate (CID 102850177) is ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate.
What is the SMILES notation for ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate?
The canonical SMILES for ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate is CCOC(=O)NC(=O)CN1CCCC2(CCCNC2)C1.
What is the InChIKey of ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate?
The InChIKey is LPKULXWERDZHBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O3/c1-2-20-13(19)16-12(18)9-17-8-4-6-14(11-17)5-3-7-15-10-14/h15H,2-11H2,1H3,(H,16,18,19).
What are the key properties of ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate?
ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate has a molecular weight of 283.37 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-(2,8-diazaspiro[5.5]undecan-2-yl)acetyl]carbamate is sourced from PubChem (CID 102850177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).