C14H28N2O — CID 102850195
2-(3-ethoxypropyl)-2,8-diazaspiro[5.5]undecane (PubChem CID 102850195) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-(3-ethoxypropyl)-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102850195 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-(3-ethoxypropyl)-2,8-diazaspiro[5.5]undecane |
| SMILES | CCOCCCN1CCCC2(CCCNC2)C1 |
| InChI | InChI=1S/C14H28N2O/c1-2-17-11-5-10-16-9-4-7-14(13-16)6-3-8-15-12-14/h15H,2-13H2,1H3 |
| InChIKey | ZHLHZTFTZDSPDF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|