About 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol
4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol (PubChem CID 82038711) has the molecular formula C18H28N2O
and a molecular weight of 288.43 g/mol. Its IUPAC name is 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol.
Molecular Properties
| Compound Name | 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol |
| PubChem CID | 82038711 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol |
| SMILES | Oc1ccc(CCCN2CCCC3(CCCNC3)C2)cc1 |
| InChI | InChI=1S/C18H28N2O/c21-17-7-5-16(6-8-17)4-1-12-20-13-3-10-18(15-20)9-2-11-19-14-18/h5-8,19,21H,1-4,9-15H2 |
| InChIKey | VUVWKZUCZVWVAY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol?
The IUPAC name of 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol (CID 82038711) is 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol.
What is the SMILES notation for 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol?
The canonical SMILES for 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol is Oc1ccc(CCCN2CCCC3(CCCNC3)C2)cc1.
What is the InChIKey of 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol?
The InChIKey is VUVWKZUCZVWVAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O/c21-17-7-5-16(6-8-17)4-1-12-20-13-3-10-18(15-20)9-2-11-19-14-18/h5-8,19,21H,1-4,9-15H2.
What are the key properties of 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol?
4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol has a molecular weight of 288.43 g/mol, XLogP of 2.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,8-diazaspiro[5.5]undecan-2-yl)propyl]phenol is sourced from PubChem (CID 82038711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).