C23H23N3O3 — CID 1028504
4-(1,3-benzodioxol-5-ylmethyl)-N-naphthalen-1-ylpiperazine-1-carboxamide (PubChem CID 1028504) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-naphthalen-1-ylpiperazine-1-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-naphthalen-1-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 1028504 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-naphthalen-1-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H23N3O3/c27-23(24-20-7-3-5-18-4-1-2-6-19(18)20)26-12-10-25(11-13-26)15-17-8-9-21-22(14-17)29-16-28-21/h1-9,14H,10-13,15-16H2,(H,24,27) |
| InChIKey | OETDQTFZHCTUIL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |