C16H21N3S — CID 102850626
2-(2,8-diazaspiro[5.5]undecan-2-yl)-1,3-benzothiazole (PubChem CID 102850626) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-(2,8-diazaspiro[5.5]undecan-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(2,8-diazaspiro[5.5]undecan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 102850626 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-(2,8-diazaspiro[5.5]undecan-2-yl)-1,3-benzothiazole |
| SMILES | c1ccc2sc(N3CCCC4(CCCNC4)C3)nc2c1 |
| InChI | InChI=1S/C16H21N3S/c1-2-6-14-13(5-1)18-15(20-14)19-10-4-8-16(12-19)7-3-9-17-11-16/h1-2,5-6,17H,3-4,7-12H2 |
| InChIKey | OQDSJNOEZZYZOJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |