C16H22N4 — CID 102850634
2-(1H-benzimidazol-2-yl)-2,8-diazaspiro[5.5]undecane (PubChem CID 102850634) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-(1H-benzimidazol-2-yl)-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102850634 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-2,8-diazaspiro[5.5]undecane |
| SMILES | c1ccc2[nH]c(N3CCCC4(CCCNC4)C3)nc2c1 |
| InChI | InChI=1S/C16H22N4/c1-2-6-14-13(5-1)18-15(19-14)20-10-4-8-16(12-20)7-3-9-17-11-16/h1-2,5-6,17H,3-4,7-12H2,(H,18,19) |
| InChIKey | WOAVVFNVWVBKLB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |