C13H18N4 — CID 10704647
2-(4-methyl-1,4-diazepan-1-yl)-1H-benzimidazole (PubChem CID 10704647) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is 2-(4-methyl-1,4-diazepan-1-yl)-1H-benzimidazole.
| Compound Name | 2-(4-methyl-1,4-diazepan-1-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 10704647 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-(4-methyl-1,4-diazepan-1-yl)-1H-benzimidazole |
| SMILES | CN1CCCN(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C13H18N4/c1-16-7-4-8-17(10-9-16)13-14-11-5-2-3-6-12(11)15-13/h2-3,5-6H,4,7-10H2,1H3,(H,14,15) |
| InChIKey | VFSPLPXSWGYUSZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |