C20H22F2N4 — CID 86892522
2-[4-[1-(2,4-difluorophenyl)ethyl]-1,4-diazepan-1-yl]-1H-benzimidazole (PubChem CID 86892522) has the molecular formula C20H22F2N4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[4-[1-(2,4-difluorophenyl)ethyl]-1,4-diazepan-1-yl]-1H-benzimidazole.
| Compound Name | 2-[4-[1-(2,4-difluorophenyl)ethyl]-1,4-diazepan-1-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 86892522 |
| Molecular Formula | C20H22F2N4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 2-[4-[1-(2,4-difluorophenyl)ethyl]-1,4-diazepan-1-yl]-1H-benzimidazole |
| SMILES | CC(c1ccc(F)cc1F)N1CCCN(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C20H22F2N4/c1-14(16-8-7-15(21)13-17(16)22)25-9-4-10-26(12-11-25)20-23-18-5-2-3-6-19(18)24-20/h2-3,5-8,13-14H,4,9-12H2,1H3,(H,23,24) |
| InChIKey | NUAYQBNTGCHAIM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |