C22H23N7O3 — CID 86885579
2-[1-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 86885579) has the molecular formula C22H23N7O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[1-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[1-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 86885579 |
| Molecular Formula | C22H23N7O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[1-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | CC(c1nnc(-c2ccc([N+](=O)[O-])cc2)o1)N1CCCN(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C22H23N7O3/c1-15(20-25-26-21(32-20)16-7-9-17(10-8-16)29(30)31)27-11-4-12-28(14-13-27)22-23-18-5-2-3-6-19(18)24-22/h2-3,5-10,15H,4,11-14H2,1H3,(H,23,24) |
| InChIKey | BVZLFWVTWPYBIM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|