C14H17BrN2O3 — CID 102852032
methyl N-[1-[4-(bromomethyl)benzoyl]pyrrolidin-3-yl]carbamate (PubChem CID 102852032) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is methyl N-[1-[4-(bromomethyl)benzoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[1-[4-(bromomethyl)benzoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 102852032 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | methyl N-[1-[4-(bromomethyl)benzoyl]pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(C(=O)c2ccc(CBr)cc2)C1 |
| InChI | InChI=1S/C14H17BrN2O3/c1-20-14(19)16-12-6-7-17(9-12)13(18)11-4-2-10(8-15)3-5-11/h2-5,12H,6-9H2,1H3,(H,16,19) |
| InChIKey | OANDGYDRUNKBHD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|