C14H15BrF2N2S — CID 102853340
5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline (PubChem CID 102853340) has the molecular formula C14H15BrF2N2S and a molecular weight of 361.26 g/mol. Its IUPAC name is 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline.
| Compound Name | 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 102853340 |
| Molecular Formula | C14H15BrF2N2S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline |
| SMILES | CC(C)(C)c1csc(CNc2cc(Br)c(F)cc2F)n1 |
| InChI | InChI=1S/C14H15BrF2N2S/c1-14(2,3)12-7-20-13(19-12)6-18-11-4-8(15)9(16)5-10(11)17/h4-5,7,18H,6H2,1-3H3 |
| InChIKey | IXBAMCBWSBYWPE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|