About 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline
5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline (PubChem CID 102853340) has the molecular formula C14H15BrF2N2S
and a molecular weight of 361.26 g/mol. Its IUPAC name is 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline.
Molecular Properties
| Compound Name | 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline |
| PubChem CID | 102853340 |
| Molecular Formula | C14H15BrF2N2S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline |
| SMILES | CC(C)(C)c1csc(CNc2cc(Br)c(F)cc2F)n1 |
| InChI | InChI=1S/C14H15BrF2N2S/c1-14(2,3)12-7-20-13(19-12)6-18-11-4-8(15)9(16)5-10(11)17/h4-5,7,18H,6H2,1-3H3 |
| InChIKey | IXBAMCBWSBYWPE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline?
The IUPAC name of 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline (CID 102853340) is 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline.
What is the SMILES notation for 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline?
The canonical SMILES for 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline is CC(C)(C)c1csc(CNc2cc(Br)c(F)cc2F)n1.
What is the InChIKey of 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline?
The InChIKey is IXBAMCBWSBYWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrF2N2S/c1-14(2,3)12-7-20-13(19-12)6-18-11-4-8(15)9(16)5-10(11)17/h4-5,7,18H,6H2,1-3H3.
What are the key properties of 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline?
5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline has a molecular weight of 361.26 g/mol, XLogP of 5.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline is sourced from PubChem (CID 102853340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).