C15H19BrF2N2O — CID 102853387
2-(5-bromo-2,4-difluoroanilino)-N-cyclohexylpropanamide (PubChem CID 102853387) has the molecular formula C15H19BrF2N2O and a molecular weight of 361.23 g/mol. Its IUPAC name is 2-(5-bromo-2,4-difluoroanilino)-N-cyclohexylpropanamide.
| Compound Name | 2-(5-bromo-2,4-difluoroanilino)-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 102853387 |
| Molecular Formula | C15H19BrF2N2O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 2-(5-bromo-2,4-difluoroanilino)-N-cyclohexylpropanamide |
| SMILES | CC(Nc1cc(Br)c(F)cc1F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H19BrF2N2O/c1-9(15(21)20-10-5-3-2-4-6-10)19-14-7-11(16)12(17)8-13(14)18/h7-10,19H,2-6H2,1H3,(H,20,21) |
| InChIKey | YJURITHMRXDHMQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|