C13H16BrF2N3O — CID 102853568
2-(5-bromo-2,4-difluoroanilino)-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 102853568) has the molecular formula C13H16BrF2N3O and a molecular weight of 348.19 g/mol. Its IUPAC name is 2-(5-bromo-2,4-difluoroanilino)-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(5-bromo-2,4-difluoroanilino)-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 102853568 |
| Molecular Formula | C13H16BrF2N3O |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-(5-bromo-2,4-difluoroanilino)-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CNc2cc(Br)c(F)cc2F)CC1 |
| InChI | InChI=1S/C13H16BrF2N3O/c1-18-2-4-19(5-3-18)13(20)8-17-12-6-9(14)10(15)7-11(12)16/h6-7,17H,2-5,8H2,1H3 |
| InChIKey | NYKUGLDMIUOLLI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|