C13H17ClFN3O — CID 107528417
2-(2-chloro-5-fluoroanilino)-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 107528417) has the molecular formula C13H17ClFN3O and a molecular weight of 285.75 g/mol. Its IUPAC name is 2-(2-chloro-5-fluoroanilino)-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2-chloro-5-fluoroanilino)-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 107528417 |
| Molecular Formula | C13H17ClFN3O |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(2-chloro-5-fluoroanilino)-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CNc2cc(F)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H17ClFN3O/c1-17-4-6-18(7-5-17)13(19)9-16-12-8-10(15)2-3-11(12)14/h2-3,8,16H,4-7,9H2,1H3 |
| InChIKey | NYJLUTIXIHYLMG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |