C14H9BrF2N2S — CID 102853861
2-(5-bromo-2,4-difluoroanilino)-6-methylsulfanylbenzonitrile (PubChem CID 102853861) has the molecular formula C14H9BrF2N2S and a molecular weight of 355.21 g/mol. Its IUPAC name is 2-(5-bromo-2,4-difluoroanilino)-6-methylsulfanylbenzonitrile.
| Compound Name | 2-(5-bromo-2,4-difluoroanilino)-6-methylsulfanylbenzonitrile |
|---|---|
| PubChem CID | 102853861 |
| Molecular Formula | C14H9BrF2N2S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 2-(5-bromo-2,4-difluoroanilino)-6-methylsulfanylbenzonitrile |
| SMILES | CSc1cccc(Nc2cc(Br)c(F)cc2F)c1C#N |
| InChI | InChI=1S/C14H9BrF2N2S/c1-20-14-4-2-3-12(8(14)7-18)19-13-5-9(15)10(16)6-11(13)17/h2-6,19H,1H3 |
| InChIKey | LWFLZDJEXWWQFF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|