C13H6BrF3N2 — CID 79513028
2-(4-bromo-2,6-difluoroanilino)-6-fluorobenzonitrile (PubChem CID 79513028) has the molecular formula C13H6BrF3N2 and a molecular weight of 327.10 g/mol. Its IUPAC name is 2-(4-bromo-2,6-difluoroanilino)-6-fluorobenzonitrile.
| Compound Name | 2-(4-bromo-2,6-difluoroanilino)-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 79513028 |
| Molecular Formula | C13H6BrF3N2 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 2-(4-bromo-2,6-difluoroanilino)-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H6BrF3N2/c14-7-4-10(16)13(11(17)5-7)19-12-3-1-2-9(15)8(12)6-18/h1-5,19H |
| InChIKey | ITLQBQDMMDCRGZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |