C13H4BrF5N2 — CID 114881261
2-bromo-6-(2,3,4,5,6-pentafluoroanilino)benzonitrile (PubChem CID 114881261) has the molecular formula C13H4BrF5N2 and a molecular weight of 363.08 g/mol. Its IUPAC name is 2-bromo-6-(2,3,4,5,6-pentafluoroanilino)benzonitrile.
| Compound Name | 2-bromo-6-(2,3,4,5,6-pentafluoroanilino)benzonitrile |
|---|---|
| PubChem CID | 114881261 |
| Molecular Formula | C13H4BrF5N2 |
| Molecular Weight | 363.08 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 2-bromo-6-(2,3,4,5,6-pentafluoroanilino)benzonitrile |
| SMILES | N#Cc1c(Br)cccc1Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H4BrF5N2/c14-6-2-1-3-7(5(6)4-20)21-13-11(18)9(16)8(15)10(17)12(13)19/h1-3,21H |
| InChIKey | ZONFIIYEHAARBY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.08 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|