C13H8BrF3N2O2 — CID 102854060
2-amino-6-(5-bromo-2,4-difluoroanilino)-3-fluorobenzoic acid (PubChem CID 102854060) has the molecular formula C13H8BrF3N2O2 and a molecular weight of 361.12 g/mol. Its IUPAC name is 2-amino-6-(5-bromo-2,4-difluoroanilino)-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-(5-bromo-2,4-difluoroanilino)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 102854060 |
| Molecular Formula | C13H8BrF3N2O2 |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 2-amino-6-(5-bromo-2,4-difluoroanilino)-3-fluorobenzoic acid |
| SMILES | Nc1c(F)ccc(Nc2cc(Br)c(F)cc2F)c1C(=O)O |
| InChI | InChI=1S/C13H8BrF3N2O2/c14-5-3-10(8(17)4-7(5)16)19-9-2-1-6(15)12(18)11(9)13(20)21/h1-4,19H,18H2,(H,20,21) |
| InChIKey | NYDJBJMQHRCECU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|