About 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid
2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid (PubChem CID 83207097) has the molecular formula C13H8F4N2O2
and a molecular weight of 300.21 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid.
Molecular Properties
| Compound Name | 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid |
| PubChem CID | 83207097 |
| Molecular Formula | C13H8F4N2O2 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid |
| SMILES | Nc1c(F)ccc(Nc2c(F)cc(F)cc2F)c1C(=O)O |
| InChI | InChI=1S/C13H8F4N2O2/c14-5-3-7(16)12(8(17)4-5)19-9-2-1-6(15)11(18)10(9)13(20)21/h1-4,19H,18H2,(H,20,21) |
| InChIKey | HLWNGILLDUKLEF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid?
The IUPAC name of 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid (CID 83207097) is 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid.
What is the SMILES notation for 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid?
The canonical SMILES for 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid is Nc1c(F)ccc(Nc2c(F)cc(F)cc2F)c1C(=O)O.
What is the InChIKey of 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid?
The InChIKey is HLWNGILLDUKLEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F4N2O2/c14-5-3-7(16)12(8(17)4-5)19-9-2-1-6(15)11(18)10(9)13(20)21/h1-4,19H,18H2,(H,20,21).
What are the key properties of 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid?
2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid has a molecular weight of 300.21 g/mol, XLogP of 3.27, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-fluoro-6-(2,4,6-trifluoroanilino)benzoic acid is sourced from PubChem (CID 83207097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).