C12H10BrF2N3O2 — CID 102854095
1-(5-bromo-2,4-difluorophenyl)-5-propan-2-yltriazole-4-carboxylic acid (PubChem CID 102854095) has the molecular formula C12H10BrF2N3O2 and a molecular weight of 346.13 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-5-propan-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-5-propan-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102854095 |
| Molecular Formula | C12H10BrF2N3O2 |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-5-propan-2-yltriazole-4-carboxylic acid |
| SMILES | CC(C)c1c(C(=O)O)nnn1-c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H10BrF2N3O2/c1-5(2)11-10(12(19)20)16-17-18(11)9-3-6(13)7(14)4-8(9)15/h3-5H,1-2H3,(H,19,20) |
| InChIKey | UWRMVODLBYOCQM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|