C20H19N3O4 — CID 174629160
1-(3-carboxy-2-methyl-5-phenylphenyl)-5-propan-2-yltriazole-4-carboxylic acid (PubChem CID 174629160) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-(3-carboxy-2-methyl-5-phenylphenyl)-5-propan-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-(3-carboxy-2-methyl-5-phenylphenyl)-5-propan-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174629160 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-(3-carboxy-2-methyl-5-phenylphenyl)-5-propan-2-yltriazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cc(-c2ccccc2)cc1-n1nnc(C(=O)O)c1C(C)C |
| InChI | InChI=1S/C20H19N3O4/c1-11(2)18-17(20(26)27)21-22-23(18)16-10-14(13-7-5-4-6-8-13)9-15(12(16)3)19(24)25/h4-11H,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | CICXQINUWUEOMM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |