C10H8BrF2N5O2S — CID 102854113
N-(5-bromo-2,4-difluorophenyl)-2-hydrazinylpyrimidine-5-sulfonamide (PubChem CID 102854113) has the molecular formula C10H8BrF2N5O2S and a molecular weight of 380.17 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-2-hydrazinylpyrimidine-5-sulfonamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-2-hydrazinylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 102854113 |
| Molecular Formula | C10H8BrF2N5O2S |
| Molecular Weight | 380.17 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-2-hydrazinylpyrimidine-5-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)Nc2cc(Br)c(F)cc2F)cn1 |
| InChI | InChI=1S/C10H8BrF2N5O2S/c11-6-1-9(8(13)2-7(6)12)18-21(19,20)5-3-15-10(17-14)16-4-5/h1-4,18H,14H2,(H,15,16,17) |
| InChIKey | YPZUHDVBELASJF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|