C6H5BrF2N2O2S — CID 102855195
1-bromo-2,4-difluoro-5-(sulfamoylamino)benzene (PubChem CID 102855195) has the molecular formula C6H5BrF2N2O2S and a molecular weight of 287.09 g/mol. Its IUPAC name is 1-bromo-2,4-difluoro-5-(sulfamoylamino)benzene.
| Compound Name | 1-bromo-2,4-difluoro-5-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 102855195 |
| Molecular Formula | C6H5BrF2N2O2S |
| Molecular Weight | 287.09 g/mol |
| Exact Mass | 285.92 |
| IUPAC Name | 1-bromo-2,4-difluoro-5-(sulfamoylamino)benzene |
| SMILES | NS(=O)(=O)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C6H5BrF2N2O2S/c7-3-1-6(11-14(10,12)13)5(9)2-4(3)8/h1-2,11H,(H2,10,12,13) |
| InChIKey | FQWQIEUHHBSEFG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.09 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|