About N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide
N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide (PubChem CID 102846862) has the molecular formula C10H7BrClF2N3O2S
and a molecular weight of 386.61 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide |
| PubChem CID | 102846862 |
| Molecular Formula | C10H7BrClF2N3O2S |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2cc(Br)c(F)cc2F)c1Cl |
| InChI | InChI=1S/C10H7BrClF2N3O2S/c1-17-4-15-10(9(17)12)20(18,19)16-8-2-5(11)6(13)3-7(8)14/h2-4,16H,1H3 |
| InChIKey | KSAMHIVOJGWXBQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide?
The IUPAC name of N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide (CID 102846862) is N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide.
What is the SMILES notation for N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide?
The canonical SMILES for N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide is Cn1cnc(S(=O)(=O)Nc2cc(Br)c(F)cc2F)c1Cl.
What is the InChIKey of N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide?
The InChIKey is KSAMHIVOJGWXBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrClF2N3O2S/c1-17-4-15-10(9(17)12)20(18,19)16-8-2-5(11)6(13)3-7(8)14/h2-4,16H,1H3.
What are the key properties of N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide?
N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide has a molecular weight of 386.61 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2,4-difluorophenyl)-5-chloro-1-methylimidazole-4-sulfonamide is sourced from PubChem (CID 102846862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).