C10H8ClF2N3O2S — CID 43415229
5-chloro-N-(3,5-difluorophenyl)-1-methylimidazole-4-sulfonamide (PubChem CID 43415229) has the molecular formula C10H8ClF2N3O2S and a molecular weight of 307.71 g/mol. Its IUPAC name is 5-chloro-N-(3,5-difluorophenyl)-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-(3,5-difluorophenyl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 43415229 |
| Molecular Formula | C10H8ClF2N3O2S |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 5-chloro-N-(3,5-difluorophenyl)-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2cc(F)cc(F)c2)c1Cl |
| InChI | InChI=1S/C10H8ClF2N3O2S/c1-16-5-14-10(9(16)11)19(17,18)15-8-3-6(12)2-7(13)4-8/h2-5,15H,1H3 |
| InChIKey | BUCVVGXLVNIJNV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |