C12H14ClN3O4S2 — CID 134006747
5-chloro-N-(4-ethylsulfonylphenyl)-1-methylimidazole-4-sulfonamide (PubChem CID 134006747) has the molecular formula C12H14ClN3O4S2 and a molecular weight of 363.85 g/mol. Its IUPAC name is 5-chloro-N-(4-ethylsulfonylphenyl)-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-(4-ethylsulfonylphenyl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 134006747 |
| Molecular Formula | C12H14ClN3O4S2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 5-chloro-N-(4-ethylsulfonylphenyl)-1-methylimidazole-4-sulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(NS(=O)(=O)c2ncn(C)c2Cl)cc1 |
| InChI | InChI=1S/C12H14ClN3O4S2/c1-3-21(17,18)10-6-4-9(5-7-10)15-22(19,20)12-11(13)16(2)8-14-12/h4-8,15H,3H2,1-2H3 |
| InChIKey | UMTASTLNRYHJMO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |