C11H9ClF3N3O2S — CID 43415186
5-chloro-1-methyl-N-[4-(trifluoromethyl)phenyl]imidazole-4-sulfonamide (PubChem CID 43415186) has the molecular formula C11H9ClF3N3O2S and a molecular weight of 339.73 g/mol. Its IUPAC name is 5-chloro-1-methyl-N-[4-(trifluoromethyl)phenyl]imidazole-4-sulfonamide.
| Compound Name | 5-chloro-1-methyl-N-[4-(trifluoromethyl)phenyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 43415186 |
| Molecular Formula | C11H9ClF3N3O2S |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 5-chloro-1-methyl-N-[4-(trifluoromethyl)phenyl]imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2ccc(C(F)(F)F)cc2)c1Cl |
| InChI | InChI=1S/C11H9ClF3N3O2S/c1-18-6-16-10(9(18)12)21(19,20)17-8-4-2-7(3-5-8)11(13,14)15/h2-6,17H,1H3 |
| InChIKey | AOFHFACIXSFBJW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |