C9H9BrF2N2O2S2 — CID 107612208
2-[(4-bromo-2,5-difluorophenyl)sulfamoyl]propanethioamide (PubChem CID 107612208) has the molecular formula C9H9BrF2N2O2S2 and a molecular weight of 359.22 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-difluorophenyl)sulfamoyl]propanethioamide.
| Compound Name | 2-[(4-bromo-2,5-difluorophenyl)sulfamoyl]propanethioamide |
|---|---|
| PubChem CID | 107612208 |
| Molecular Formula | C9H9BrF2N2O2S2 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 2-[(4-bromo-2,5-difluorophenyl)sulfamoyl]propanethioamide |
| SMILES | CC(C(N)=S)S(=O)(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C9H9BrF2N2O2S2/c1-4(9(13)17)18(15,16)14-8-3-6(11)5(10)2-7(8)12/h2-4,14H,1H3,(H2,13,17) |
| InChIKey | VRBUVPNBGCRTCB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|