C13H7BrF4N2S — CID 107612233
4-(4-bromo-2,5-difluoroanilino)-3,5-difluorobenzenecarbothioamide (PubChem CID 107612233) has the molecular formula C13H7BrF4N2S and a molecular weight of 379.18 g/mol. Its IUPAC name is 4-(4-bromo-2,5-difluoroanilino)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(4-bromo-2,5-difluoroanilino)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107612233 |
| Molecular Formula | C13H7BrF4N2S |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | 4-(4-bromo-2,5-difluoroanilino)-3,5-difluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)c(Nc2cc(F)c(Br)cc2F)c(F)c1 |
| InChI | InChI=1S/C13H7BrF4N2S/c14-6-3-8(16)11(4-7(6)15)20-12-9(17)1-5(13(19)21)2-10(12)18/h1-4,20H,(H2,19,21) |
| InChIKey | WSSYZMDGKUZVFZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|