C14H13F2N3S — CID 81286283
4-[(2,6-dimethyl-3-pyridinyl)amino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286283) has the molecular formula C14H13F2N3S and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-[(2,6-dimethyl-3-pyridinyl)amino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[(2,6-dimethyl-3-pyridinyl)amino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286283 |
| Molecular Formula | C14H13F2N3S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-[(2,6-dimethyl-3-pyridinyl)amino]-3,5-difluorobenzenecarbothioamide |
| SMILES | Cc1ccc(Nc2c(F)cc(C(N)=S)cc2F)c(C)n1 |
| InChI | InChI=1S/C14H13F2N3S/c1-7-3-4-12(8(2)18-7)19-13-10(15)5-9(14(17)20)6-11(13)16/h3-6,19H,1-2H3,(H2,17,20) |
| InChIKey | BETFHXJSSPUJCK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|