C15H14F2N2S — CID 81286157
4-(3,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide (PubChem CID 81286157) has the molecular formula C15H14F2N2S and a molecular weight of 292.35 g/mol. Its IUPAC name is 4-(3,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(3,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286157 |
| Molecular Formula | C15H14F2N2S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-(3,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide |
| SMILES | Cc1ccc(Nc2c(F)cc(C(N)=S)cc2F)cc1C |
| InChI | InChI=1S/C15H14F2N2S/c1-8-3-4-11(5-9(8)2)19-14-12(16)6-10(15(18)20)7-13(14)17/h3-7,19H,1-2H3,(H2,18,20) |
| InChIKey | KXLOKOZICNBDIW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|