C14H10Cl2F2N2S — CID 81285280
4-(2,6-dichloro-3-methylanilino)-3,5-difluorobenzenecarbothioamide (PubChem CID 81285280) has the molecular formula C14H10Cl2F2N2S and a molecular weight of 347.22 g/mol. Its IUPAC name is 4-(2,6-dichloro-3-methylanilino)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(2,6-dichloro-3-methylanilino)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81285280 |
| Molecular Formula | C14H10Cl2F2N2S |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 4-(2,6-dichloro-3-methylanilino)-3,5-difluorobenzenecarbothioamide |
| SMILES | Cc1ccc(Cl)c(Nc2c(F)cc(C(N)=S)cc2F)c1Cl |
| InChI | InChI=1S/C14H10Cl2F2N2S/c1-6-2-3-8(15)12(11(6)16)20-13-9(17)4-7(14(19)21)5-10(13)18/h2-5,20H,1H3,(H2,19,21) |
| InChIKey | NCRQNXNCWLCTCX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|