C9H13N3O2S2 — CID 79043469
2-[(2-methyl-3-pyridinyl)sulfamoyl]propanethioamide (PubChem CID 79043469) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-[(2-methyl-3-pyridinyl)sulfamoyl]propanethioamide.
| Compound Name | 2-[(2-methyl-3-pyridinyl)sulfamoyl]propanethioamide |
|---|---|
| PubChem CID | 79043469 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-[(2-methyl-3-pyridinyl)sulfamoyl]propanethioamide |
| SMILES | Cc1ncccc1NS(=O)(=O)C(C)C(N)=S |
| InChI | InChI=1S/C9H13N3O2S2/c1-6-8(4-3-5-11-6)12-16(13,14)7(2)9(10)15/h3-5,7,12H,1-2H3,(H2,10,15) |
| InChIKey | JQMTXAVOPSLQJP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|