C12H11BrF2N2O3S — CID 106087052
N-(5-bromo-2,4-difluorophenyl)-5-(methylaminomethyl)furan-2-sulfonamide (PubChem CID 106087052) has the molecular formula C12H11BrF2N2O3S and a molecular weight of 381.20 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-5-(methylaminomethyl)furan-2-sulfonamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-5-(methylaminomethyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 106087052 |
| Molecular Formula | C12H11BrF2N2O3S |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-5-(methylaminomethyl)furan-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)Nc2cc(Br)c(F)cc2F)o1 |
| InChI | InChI=1S/C12H11BrF2N2O3S/c1-16-6-7-2-3-12(20-7)21(18,19)17-11-4-8(13)9(14)5-10(11)15/h2-5,16-17H,6H2,1H3 |
| InChIKey | IUUJHNPCOISDOX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|