C10H12N2O3S2 — CID 106070081
5-(methylaminomethyl)-N-thiophen-3-ylfuran-2-sulfonamide (PubChem CID 106070081) has the molecular formula C10H12N2O3S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-thiophen-3-ylfuran-2-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-thiophen-3-ylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 106070081 |
| Molecular Formula | C10H12N2O3S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-(methylaminomethyl)-N-thiophen-3-ylfuran-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)Nc2ccsc2)o1 |
| InChI | InChI=1S/C10H12N2O3S2/c1-11-6-9-2-3-10(15-9)17(13,14)12-8-4-5-16-7-8/h2-5,7,11-12H,6H2,1H3 |
| InChIKey | SQYUPCKLOWHYEI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |