C11H14N2O2S3 — CID 114141603
4-methyl-5-(methylaminomethyl)-N-thiophen-3-ylthiophene-2-sulfonamide (PubChem CID 114141603) has the molecular formula C11H14N2O2S3 and a molecular weight of 302.45 g/mol. Its IUPAC name is 4-methyl-5-(methylaminomethyl)-N-thiophen-3-ylthiophene-2-sulfonamide.
| Compound Name | 4-methyl-5-(methylaminomethyl)-N-thiophen-3-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114141603 |
| Molecular Formula | C11H14N2O2S3 |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-methyl-5-(methylaminomethyl)-N-thiophen-3-ylthiophene-2-sulfonamide |
| SMILES | CNCc1sc(S(=O)(=O)Nc2ccsc2)cc1C |
| InChI | InChI=1S/C11H14N2O2S3/c1-8-5-11(17-10(8)6-12-2)18(14,15)13-9-3-4-16-7-9/h3-5,7,12-13H,6H2,1-2H3 |
| InChIKey | MHJRTPUJNKWWCK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |