C12H16N2O2S3 — CID 106056610
5-(aminomethyl)-4-methyl-N-(1-thiophen-3-ylethyl)thiophene-2-sulfonamide (PubChem CID 106056610) has the molecular formula C12H16N2O2S3 and a molecular weight of 316.47 g/mol. Its IUPAC name is 5-(aminomethyl)-4-methyl-N-(1-thiophen-3-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-4-methyl-N-(1-thiophen-3-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106056610 |
| Molecular Formula | C12H16N2O2S3 |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-(aminomethyl)-4-methyl-N-(1-thiophen-3-ylethyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)c2ccsc2)sc1CN |
| InChI | InChI=1S/C12H16N2O2S3/c1-8-5-12(18-11(8)6-13)19(15,16)14-9(2)10-3-4-17-7-10/h3-5,7,9,14H,6,13H2,1-2H3 |
| InChIKey | WTKKUSAIDIRPLB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |