C14H16FNO2S2 — CID 107327103
4-fluoro-2,6-dimethyl-N-(1-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 107327103) has the molecular formula C14H16FNO2S2 and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-N-(1-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-2,6-dimethyl-N-(1-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107327103 |
| Molecular Formula | C14H16FNO2S2 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-N-(1-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NC(C)c1ccsc1 |
| InChI | InChI=1S/C14H16FNO2S2/c1-9-6-13(15)7-10(2)14(9)20(17,18)16-11(3)12-4-5-19-8-12/h4-8,11,16H,1-3H3 |
| InChIKey | KEYBAENODTUBJJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |