C14H7BrCl2F2N2 — CID 102854323
1-(5-bromo-2,4-difluorophenyl)-4-chloro-2-(chloromethyl)benzimidazole (PubChem CID 102854323) has the molecular formula C14H7BrCl2F2N2 and a molecular weight of 392.03 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-4-chloro-2-(chloromethyl)benzimidazole.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-4-chloro-2-(chloromethyl)benzimidazole |
|---|---|
| PubChem CID | 102854323 |
| Molecular Formula | C14H7BrCl2F2N2 |
| Molecular Weight | 392.03 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-4-chloro-2-(chloromethyl)benzimidazole |
| SMILES | Fc1cc(F)c(-n2c(CCl)nc3c(Cl)cccc32)cc1Br |
| InChI | InChI=1S/C14H7BrCl2F2N2/c15-7-4-12(10(19)5-9(7)18)21-11-3-1-2-8(17)14(11)20-13(21)6-16/h1-5H,6H2 |
| InChIKey | RKEZEYJIIRKBIG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|