C14H7Cl4FN2 — CID 104838594
4-chloro-2-(chloromethyl)-1-(2,6-dichloro-4-fluorophenyl)benzimidazole (PubChem CID 104838594) has the molecular formula C14H7Cl4FN2 and a molecular weight of 364.03 g/mol. Its IUPAC name is 4-chloro-2-(chloromethyl)-1-(2,6-dichloro-4-fluorophenyl)benzimidazole.
| Compound Name | 4-chloro-2-(chloromethyl)-1-(2,6-dichloro-4-fluorophenyl)benzimidazole |
|---|---|
| PubChem CID | 104838594 |
| Molecular Formula | C14H7Cl4FN2 |
| Molecular Weight | 364.03 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 4-chloro-2-(chloromethyl)-1-(2,6-dichloro-4-fluorophenyl)benzimidazole |
| SMILES | Fc1cc(Cl)c(-n2c(CCl)nc3c(Cl)cccc32)c(Cl)c1 |
| InChI | InChI=1S/C14H7Cl4FN2/c15-6-12-20-13-8(16)2-1-3-11(13)21(12)14-9(17)4-7(19)5-10(14)18/h1-5H,6H2 |
| InChIKey | FWFPDOFCFOWLAL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.03 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|