C14H15BrF2N2O2 — CID 102855290
1-(5-bromo-2,4-difluorophenyl)-3-(2-methylpropyl)piperazine-2,5-dione (PubChem CID 102855290) has the molecular formula C14H15BrF2N2O2 and a molecular weight of 361.19 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-3-(2-methylpropyl)piperazine-2,5-dione.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-3-(2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 102855290 |
| Molecular Formula | C14H15BrF2N2O2 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-3-(2-methylpropyl)piperazine-2,5-dione |
| SMILES | CC(C)CC1NC(=O)CN(c2cc(Br)c(F)cc2F)C1=O |
| InChI | InChI=1S/C14H15BrF2N2O2/c1-7(2)3-11-14(21)19(6-13(20)18-11)12-4-8(15)9(16)5-10(12)17/h4-5,7,11H,3,6H2,1-2H3,(H,18,20) |
| InChIKey | QQUGJMDZWLFKJW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|