C15H19BrN2O2 — CID 64962057
1-(2-bromo-4-methylphenyl)-3-(2-methylpropyl)piperazine-2,5-dione (PubChem CID 64962057) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-3-(2-methylpropyl)piperazine-2,5-dione.
| Compound Name | 1-(2-bromo-4-methylphenyl)-3-(2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64962057 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-3-(2-methylpropyl)piperazine-2,5-dione |
| SMILES | Cc1ccc(N2CC(=O)NC(CC(C)C)C2=O)c(Br)c1 |
| InChI | InChI=1S/C15H19BrN2O2/c1-9(2)6-12-15(20)18(8-14(19)17-12)13-5-4-10(3)7-11(13)16/h4-5,7,9,12H,6,8H2,1-3H3,(H,17,19) |
| InChIKey | UANWLPNAFXZAQS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |